3-Methyl-5-nitrobenzoic acid
5-Nitro-3-Methyl benzoic acid
CAS: 113882-33-0
Molecular Formula: C8H7NO4
3-Methyl-5-nitrobenzoic acid - Names and Identifiers
| Name | 5-Nitro-3-Methyl benzoic acid |
| Synonyms | 3-Methyl-5-nitrobenzoicaci 3-Methyl-5-nitrobenzoic acid 3-methyl-5-nitrobenzoic acid 5-Nitro-3-Methyl benzoic acid Benzoic acid, 3-methyl-5-nitro- |
| CAS | 113882-33-0 |
| InChI | InChI=1S/C8H7NO4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3,(H,10,11) |
3-Methyl-5-nitrobenzoic acid - Physico-chemical Properties
| Molecular Formula | C8H7NO4 |
| Molar Mass | 181.15 |
| Density | 1.392±0.06 g/cm3(Predicted) |
| Melting Point | 174℃ |
| Boling Point | 355.8±30.0 °C(Predicted) |
| pKa | 3.55±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
3-Methyl-5-nitrobenzoic acid - Introduction
3-Methyl-5-nitrobenzoic acid (abbreviated as MNBA) is an organic compound with the chemical formula C8H7NO4. The following is a description of the nature, use, manufacturing and safety information of the MNBA:
Nature:
1. Appearance: MNBA is a yellow crystal, which can be needle-like or flaky.
2. Melting point: Its melting point is about 178-180 degrees Celsius.
3. Solubility: MNBA is soluble in organic solvents such as ethanol, benzene and dichloromethane, and slightly soluble in water.
Use:
1. pharmaceutical field: MNBA can be used as an intermediate in the manufacture of certain drugs, such as the synthetic raw material of anti-inflammatory drug cloxacillin.
2. Dye field: MNBA can be used as a synthetic raw material for organic dyes.
3. Chemical research: Because of its special structure and properties, MNBA is also widely used in chemical research.
Method:
The preparation of MNBA is usually achieved by alkylation of methyl nitrobenzoic acid. A common preparation method is to react methyl nitrobenzoic acid with a chemical reducing agent (such as sodium sulfite) to reduce the nitro (NO2) group with sulfite ions to produce 3-methyl-5-nitrobenzoic acid.
Safety Information:
1. MNBA is irritating and contact with skin and eyes may cause irritation and burns.
2. it may cause adverse effects on the environment and should be handled with care.
3. When using or storing MNBA, appropriate protective measures should be taken, such as wearing protective gloves, glasses and protective clothing.
4. For the handling and disposal of MNBA, chemical safety practices and relevant regulations should be followed.
Nature:
1. Appearance: MNBA is a yellow crystal, which can be needle-like or flaky.
2. Melting point: Its melting point is about 178-180 degrees Celsius.
3. Solubility: MNBA is soluble in organic solvents such as ethanol, benzene and dichloromethane, and slightly soluble in water.
Use:
1. pharmaceutical field: MNBA can be used as an intermediate in the manufacture of certain drugs, such as the synthetic raw material of anti-inflammatory drug cloxacillin.
2. Dye field: MNBA can be used as a synthetic raw material for organic dyes.
3. Chemical research: Because of its special structure and properties, MNBA is also widely used in chemical research.
Method:
The preparation of MNBA is usually achieved by alkylation of methyl nitrobenzoic acid. A common preparation method is to react methyl nitrobenzoic acid with a chemical reducing agent (such as sodium sulfite) to reduce the nitro (NO2) group with sulfite ions to produce 3-methyl-5-nitrobenzoic acid.
Safety Information:
1. MNBA is irritating and contact with skin and eyes may cause irritation and burns.
2. it may cause adverse effects on the environment and should be handled with care.
3. When using or storing MNBA, appropriate protective measures should be taken, such as wearing protective gloves, glasses and protective clothing.
4. For the handling and disposal of MNBA, chemical safety practices and relevant regulations should be followed.
Last Update：2024-04-09 21:04:16
